C9H17N3O7 — CID 19775744
2-aminobutanedioic acid;2,5-diamino-5-oxopentanoic acid (PubChem CID 19775744) has the molecular formula C9H17N3O7 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-aminobutanedioic acid;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 2-aminobutanedioic acid;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19775744 |
| Molecular Formula | C9H17N3O7 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-aminobutanedioic acid;2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C4H7NO4/c6-3(5(9)10)1-2-4(7)8;5-2(4(8)9)1-3(6)7/h3H,1-2,6H2,(H2,7,8)(H,9,10);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | RGOIEYAZJSYLJT-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 207.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |