C6H12N2O4S2 — CID 174888864
2-aminopentanedioic acid;carbamodithioic acid (PubChem CID 174888864) has the molecular formula C6H12N2O4S2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-aminopentanedioic acid;carbamodithioic acid.
| Compound Name | 2-aminopentanedioic acid;carbamodithioic acid |
|---|---|
| PubChem CID | 174888864 |
| Molecular Formula | C6H12N2O4S2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-aminopentanedioic acid;carbamodithioic acid |
| SMILES | NC(=S)S.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.CH3NS2/c6-3(5(9)10)1-2-4(7)8;2-1(3)4/h3H,1-2,6H2,(H,7,8)(H,9,10);(H3,2,3,4) |
| InChIKey | XQDKHPMDQTUINW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|