C6H13N3O4S — CID 87523722
(2S)-2-aminopentanedioic acid;thiourea (PubChem CID 87523722) has the molecular formula C6H13N3O4S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;thiourea.
| Compound Name | (2S)-2-aminopentanedioic acid;thiourea |
|---|---|
| PubChem CID | 87523722 |
| Molecular Formula | C6H13N3O4S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;thiourea |
| SMILES | NC(N)=S.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.CH4N2S/c6-3(5(9)10)1-2-4(7)8;2-1(3)4/h3H,1-2,6H2,(H,7,8)(H,9,10);(H4,2,3,4)/t3-;/m0./s1 |
| InChIKey | XLVXCIFKESYXBQ-DFWYDOINSA-N |
| XLogP | -1.55 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|