C6H15N7O4 — CID 56625944
(diamino(114C)methylideneamino) (2S)-2-amino-4-(diaminomethylideneamino)oxybutaneperoxoate (PubChem CID 56625944) has the molecular formula C6H15N7O4 and a molecular weight of 251.22 g/mol. Its IUPAC name is (diamino(114C)methylideneamino) (2S)-2-amino-4-(diaminomethylideneamino)oxybutaneperoxoate.
| Compound Name | (diamino(114C)methylideneamino) (2S)-2-amino-4-(diaminomethylideneamino)oxybutaneperoxoate |
|---|---|
| PubChem CID | 56625944 |
| Molecular Formula | C6H15N7O4 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (diamino(114C)methylideneamino) (2S)-2-amino-4-(diaminomethylideneamino)oxybutaneperoxoate |
| SMILES | NC(N)=NOCC[C@H](N)C(=O)OON=[14C](N)N |
| InChI | InChI=1S/C6H15N7O4/c7-3(1-2-15-12-5(8)9)4(14)16-17-13-6(10)11/h3H,1-2,7H2,(H4,8,9,12)(H4,10,11,13)/t3-/m0/s1/i6+2 |
| InChIKey | LVPHMUGTASMUMI-ZGLVNURNSA-N |
| XLogP | -3.43 |
| TPSA | 199.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|