C11H26N4O2 — CID 171650386
ethane;2-[4-oxo-3-(propan-2-ylamino)pentoxy]guanidine (PubChem CID 171650386) has the molecular formula C11H26N4O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;2-[4-oxo-3-(propan-2-ylamino)pentoxy]guanidine.
| Compound Name | ethane;2-[4-oxo-3-(propan-2-ylamino)pentoxy]guanidine |
|---|---|
| PubChem CID | 171650386 |
| Molecular Formula | C11H26N4O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | ethane;2-[4-oxo-3-(propan-2-ylamino)pentoxy]guanidine |
| SMILES | CC.CC(=O)C(CCON=C(N)N)NC(C)C |
| InChI | InChI=1S/C9H20N4O2.C2H6/c1-6(2)12-8(7(3)14)4-5-15-13-9(10)11;1-2/h6,8,12H,4-5H2,1-3H3,(H4,10,11,13);1-2H3 |
| InChIKey | HQDJWHDWFQPRFU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|