C10H18N4O7 — CID 139719400
4-[2-amino-5-(diaminomethylideneamino)pentanoyl]peroxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 139719400) has the molecular formula C10H18N4O7 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-[2-amino-5-(diaminomethylideneamino)pentanoyl]peroxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[2-amino-5-(diaminomethylideneamino)pentanoyl]peroxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139719400 |
| Molecular Formula | C10H18N4O7 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[2-amino-5-(diaminomethylideneamino)pentanoyl]peroxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)OOC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C10H18N4O7/c11-5(2-1-3-14-10(12)13)9(19)21-20-7(16)4-6(15)8(17)18/h5-6,15H,1-4,11H2,(H,17,18)(H4,12,13,14) |
| InChIKey | YSKGWYRDQSDDCR-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|