2-amino-3-(2,6-difluorophenoxy)propanoic acid

C9H9F2NO3 — CID 81269565

IUPAC2-amino-3-(2,6-difluorophenoxy)propanoic acid
SMILESNC(COc1c(F)cccc1F)C(=O)O
InChIInChI=1S/C9H9F2NO3/c10-5-2-1-3-6(11)8(5)15-4-7(12)9(13)14/h1-3,7H,4,12H2,(H,13,14)
InChIKeyXUAHULNSXACRFW-UHFFFAOYSA-N
MW217.17 g/mol
LogP0.76
Rot. Bonds4

About 2-amino-3-(2,6-difluorophenoxy)propanoic acid

2-amino-3-(2,6-difluorophenoxy)propanoic acid (PubChem CID 81269565) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 2-amino-3-(2,6-difluorophenoxy)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(2,6-difluorophenoxy)propanoic acid
PubChem CID81269565
Molecular FormulaC9H9F2NO3
Molecular Weight217.17 g/mol
Exact Mass217.06
IUPAC Name2-amino-3-(2,6-difluorophenoxy)propanoic acid
SMILESNC(COc1c(F)cccc1F)C(=O)O
InChIInChI=1S/C9H9F2NO3/c10-5-2-1-3-6(11)8(5)15-4-7(12)9(13)14/h1-3,7H,4,12H2,(H,13,14)
InChIKeyXUAHULNSXACRFW-UHFFFAOYSA-N
XLogP0.76
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.17
LogP ≤ 50.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-3-(2,6-difluorophenoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(2,6-difluorophenoxy)propanoic acid?
The IUPAC name of 2-amino-3-(2,6-difluorophenoxy)propanoic acid (CID 81269565) is 2-amino-3-(2,6-difluorophenoxy)propanoic acid.
What is the SMILES notation for 2-amino-3-(2,6-difluorophenoxy)propanoic acid?
The canonical SMILES for 2-amino-3-(2,6-difluorophenoxy)propanoic acid is NC(COc1c(F)cccc1F)C(=O)O.
What is the InChIKey of 2-amino-3-(2,6-difluorophenoxy)propanoic acid?
The InChIKey is XUAHULNSXACRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO3/c10-5-2-1-3-6(11)8(5)15-4-7(12)9(13)14/h1-3,7H,4,12H2,(H,13,14).
What are the key properties of 2-amino-3-(2,6-difluorophenoxy)propanoic acid?
2-amino-3-(2,6-difluorophenoxy)propanoic acid has a molecular weight of 217.17 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,6-difluorophenoxy)propanoic acid is sourced from PubChem (CID 81269565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).