C11H12F2O2 — CID 81268709
1-(2,6-difluorophenoxy)-3-methylbutan-2-one (PubChem CID 81268709) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 1-(2,6-difluorophenoxy)-3-methylbutan-2-one.
| Compound Name | 1-(2,6-difluorophenoxy)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 81268709 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(2,6-difluorophenoxy)-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C11H12F2O2/c1-7(2)10(14)6-15-11-8(12)4-3-5-9(11)13/h3-5,7H,6H2,1-2H3 |
| InChIKey | FLJHTRIDELARCU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |