C12H13F4NO2 — CID 103289374
1-(cyclopropylamino)-3-(2,3,5,6-tetrafluorophenoxy)propan-2-ol (PubChem CID 103289374) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-(2,3,5,6-tetrafluorophenoxy)propan-2-ol.
| Compound Name | 1-(cyclopropylamino)-3-(2,3,5,6-tetrafluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 103289374 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-(cyclopropylamino)-3-(2,3,5,6-tetrafluorophenoxy)propan-2-ol |
| SMILES | OC(CNC1CC1)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H13F4NO2/c13-8-3-9(14)11(16)12(10(8)15)19-5-7(18)4-17-6-1-2-6/h3,6-7,17-18H,1-2,4-5H2 |
| InChIKey | DJDMXTUFDVXIBM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|