C10H10F4O2 — CID 103289730
1-(2,3,5,6-tetrafluorophenoxy)butan-2-ol (PubChem CID 103289730) has the molecular formula C10H10F4O2 and a molecular weight of 238.18 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluorophenoxy)butan-2-ol.
| Compound Name | 1-(2,3,5,6-tetrafluorophenoxy)butan-2-ol |
|---|---|
| PubChem CID | 103289730 |
| Molecular Formula | C10H10F4O2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(2,3,5,6-tetrafluorophenoxy)butan-2-ol |
| SMILES | CCC(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H10F4O2/c1-2-5(15)4-16-10-8(13)6(11)3-7(12)9(10)14/h3,5,15H,2,4H2,1H3 |
| InChIKey | JXXNVIHRWBACAW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|