C13H15BrF4O — CID 103289405
3-[2-(bromomethyl)-3,3-dimethylbutoxy]-1,2,4,5-tetrafluorobenzene (PubChem CID 103289405) has the molecular formula C13H15BrF4O and a molecular weight of 343.16 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3,3-dimethylbutoxy]-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-[2-(bromomethyl)-3,3-dimethylbutoxy]-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 103289405 |
| Molecular Formula | C13H15BrF4O |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 3-[2-(bromomethyl)-3,3-dimethylbutoxy]-1,2,4,5-tetrafluorobenzene |
| SMILES | CC(C)(C)C(CBr)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H15BrF4O/c1-13(2,3)7(5-14)6-19-12-10(17)8(15)4-9(16)11(12)18/h4,7H,5-6H2,1-3H3 |
| InChIKey | HUGRPBCKCCANPE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|