C14H18BrF3O — CID 65016574
1-[2-(bromomethyl)-3,3-dimethylbutoxy]-4-(trifluoromethyl)benzene (PubChem CID 65016574) has the molecular formula C14H18BrF3O and a molecular weight of 339.20 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 65016574 |
| Molecular Formula | C14H18BrF3O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-4-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)C(CBr)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18BrF3O/c1-13(2,3)11(8-15)9-19-12-6-4-10(5-7-12)14(16,17)18/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | JSIJFXVJMUXZAT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|