C13H17Br2FO — CID 65203647
1-bromo-4-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-fluorobenzene (PubChem CID 65203647) has the molecular formula C13H17Br2FO and a molecular weight of 368.08 g/mol. Its IUPAC name is 1-bromo-4-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-fluorobenzene.
| Compound Name | 1-bromo-4-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-fluorobenzene |
|---|---|
| PubChem CID | 65203647 |
| Molecular Formula | C13H17Br2FO |
| Molecular Weight | 368.08 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-bromo-4-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-fluorobenzene |
| SMILES | CC(C)(C)C(CBr)COc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H17Br2FO/c1-13(2,3)9(7-14)8-17-10-4-5-11(15)12(16)6-10/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | XRDBASSLSRHFPM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.08 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|