C10H12BrFO3 — CID 129250594
(2R)-3-(4-bromo-3-fluorophenoxy)-2-methylpropane-1,2-diol (PubChem CID 129250594) has the molecular formula C10H12BrFO3 and a molecular weight of 279.11 g/mol. Its IUPAC name is (2R)-3-(4-bromo-3-fluorophenoxy)-2-methylpropane-1,2-diol.
| Compound Name | (2R)-3-(4-bromo-3-fluorophenoxy)-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 129250594 |
| Molecular Formula | C10H12BrFO3 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | (2R)-3-(4-bromo-3-fluorophenoxy)-2-methylpropane-1,2-diol |
| SMILES | C[C@@](O)(CO)COc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C10H12BrFO3/c1-10(14,5-13)6-15-7-2-3-8(11)9(12)4-7/h2-4,13-14H,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | RJTCSZUOAUNFSI-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |