C11H12F4OS — CID 103290616
2,2-dimethyl-3-(2,3,5,6-tetrafluorophenoxy)propane-1-thiol (PubChem CID 103290616) has the molecular formula C11H12F4OS and a molecular weight of 268.27 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenoxy)propane-1-thiol.
| Compound Name | 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenoxy)propane-1-thiol |
|---|---|
| PubChem CID | 103290616 |
| Molecular Formula | C11H12F4OS |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenoxy)propane-1-thiol |
| SMILES | CC(C)(CS)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H12F4OS/c1-11(2,5-17)4-16-10-8(14)6(12)3-7(13)9(10)15/h3,17H,4-5H2,1-2H3 |
| InChIKey | MCLNDUXXYUJXFD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|