C11H11F4NO3 — CID 103290156
2-methyl-2-(methylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoic acid (PubChem CID 103290156) has the molecular formula C11H11F4NO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 103290156 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-methyl-2-(methylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoic acid |
| SMILES | CNC(C)(COc1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H11F4NO3/c1-11(16-2,10(17)18)4-19-9-7(14)5(12)3-6(13)8(9)15/h3,16H,4H2,1-2H3,(H,17,18) |
| InChIKey | YRYJBSRMDSZRKW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|