C13H16F4N2O2 — CID 103290137
2-methyl-2-(propan-2-ylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanamide (PubChem CID 103290137) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-methyl-2-(propan-2-ylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanamide.
| Compound Name | 2-methyl-2-(propan-2-ylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanamide |
|---|---|
| PubChem CID | 103290137 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-methyl-2-(propan-2-ylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanamide |
| SMILES | CC(C)NC(C)(COc1c(F)c(F)cc(F)c1F)C(N)=O |
| InChI | InChI=1S/C13H16F4N2O2/c1-6(2)19-13(3,12(18)20)5-21-11-9(16)7(14)4-8(15)10(11)17/h4,6,19H,5H2,1-3H3,(H2,18,20) |
| InChIKey | GTMOQUMCSUNNBB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|