C13H14F4N2O — CID 103289965
2-(ethylamino)-2-methyl-4-(2,3,5,6-tetrafluorophenoxy)butanenitrile (PubChem CID 103289965) has the molecular formula C13H14F4N2O and a molecular weight of 290.26 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-4-(2,3,5,6-tetrafluorophenoxy)butanenitrile.
| Compound Name | 2-(ethylamino)-2-methyl-4-(2,3,5,6-tetrafluorophenoxy)butanenitrile |
|---|---|
| PubChem CID | 103289965 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-(ethylamino)-2-methyl-4-(2,3,5,6-tetrafluorophenoxy)butanenitrile |
| SMILES | CCNC(C)(C#N)CCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H14F4N2O/c1-3-19-13(2,7-18)4-5-20-12-10(16)8(14)6-9(15)11(12)17/h6,19H,3-5H2,1-2H3 |
| InChIKey | XONPTXBMLSIWCE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|