C21H28O4 — CID 59871731
1-[4-[[4-(2-hydroxybutoxy)phenyl]methyl]phenoxy]butan-2-ol (PubChem CID 59871731) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[4-[[4-(2-hydroxybutoxy)phenyl]methyl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[[4-(2-hydroxybutoxy)phenyl]methyl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 59871731 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-[[4-(2-hydroxybutoxy)phenyl]methyl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(Cc2ccc(OCC(O)CC)cc2)cc1 |
| InChI | InChI=1S/C21H28O4/c1-3-18(22)14-24-20-9-5-16(6-10-20)13-17-7-11-21(12-8-17)25-15-19(23)4-2/h5-12,18-19,22-23H,3-4,13-15H2,1-2H3 |
| InChIKey | JQIQHABWAMZLOA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |