C19H23FO4 — CID 159194222
1-fluoro-3-[4-[[4-(2-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol (PubChem CID 159194222) has the molecular formula C19H23FO4 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-fluoro-3-[4-[[4-(2-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-fluoro-3-[4-[[4-(2-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 159194222 |
| Molecular Formula | C19H23FO4 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-fluoro-3-[4-[[4-(2-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol |
| SMILES | CC(O)COc1ccc(Cc2ccc(OCC(O)CF)cc2)cc1 |
| InChI | InChI=1S/C19H23FO4/c1-14(21)12-23-18-6-2-15(3-7-18)10-16-4-8-19(9-5-16)24-13-17(22)11-20/h2-9,14,17,21-22H,10-13H2,1H3 |
| InChIKey | KBNAGWAKCIUFEW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |