C18H20FO3W- — CID 160707756
1-[4-[(4-ethoxyphenyl)methyl]phenoxy]-3-fluoropropan-2-ol;tungsten (PubChem CID 160707756) has the molecular formula C18H20FO3W- and a molecular weight of 487.19 g/mol. Its IUPAC name is 1-[4-[(4-ethoxyphenyl)methyl]phenoxy]-3-fluoropropan-2-ol;tungsten.
| Compound Name | 1-[4-[(4-ethoxyphenyl)methyl]phenoxy]-3-fluoropropan-2-ol;tungsten |
|---|---|
| PubChem CID | 160707756 |
| Molecular Formula | C18H20FO3W- |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 1-[4-[(4-ethoxyphenyl)methyl]phenoxy]-3-fluoropropan-2-ol;tungsten |
| SMILES | [CH2-]COc1ccc(Cc2ccc(OCC(O)CF)cc2)cc1.[W] |
| InChI | InChI=1S/C18H20FO3.W/c1-2-21-17-7-3-14(4-8-17)11-15-5-9-18(10-6-15)22-13-16(20)12-19;/h3-10,16,20H,1-2,11-13H2;/q-1; |
| InChIKey | OUCCQSOINYEJPD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|