C19H26NO2+ — CID 66955250
[3-(4-benzylphenoxy)-2-hydroxypropyl]-trimethylazanium (PubChem CID 66955250) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is [3-(4-benzylphenoxy)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-(4-benzylphenoxy)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 66955250 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [3-(4-benzylphenoxy)-2-hydroxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)COc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26NO2/c1-20(2,3)14-18(21)15-22-19-11-9-17(10-12-19)13-16-7-5-4-6-8-16/h4-12,18,21H,13-15H2,1-3H3/q+1 |
| InChIKey | WJSLJOKCQFHLNW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|