C22H31ClO4 — CID 143919870
1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]methyl]phenoxy]butan-2-ol;ethane (PubChem CID 143919870) has the molecular formula C22H31ClO4 and a molecular weight of 394.94 g/mol. Its IUPAC name is 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]methyl]phenoxy]butan-2-ol;ethane.
| Compound Name | 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]methyl]phenoxy]butan-2-ol;ethane |
|---|---|
| PubChem CID | 143919870 |
| Molecular Formula | C22H31ClO4 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]methyl]phenoxy]butan-2-ol;ethane |
| SMILES | CC.CCC(O)COc1ccc(Cc2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C20H25ClO4.C2H6/c1-2-17(22)13-24-19-7-3-15(4-8-19)11-16-5-9-20(10-6-16)25-14-18(23)12-21;1-2/h3-10,17-18,22-23H,2,11-14H2,1H3;1-2H3 |
| InChIKey | YWRFFGMJADJSRR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|