C20H24Cl2O4 — CID 101328609
1-chloro-3-[4-[1-[4-(3-chloro-2-hydroxypropoxy)phenyl]ethyl]phenoxy]propan-2-ol (PubChem CID 101328609) has the molecular formula C20H24Cl2O4 and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-chloro-3-[4-[1-[4-(3-chloro-2-hydroxypropoxy)phenyl]ethyl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[1-[4-(3-chloro-2-hydroxypropoxy)phenyl]ethyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 101328609 |
| Molecular Formula | C20H24Cl2O4 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-chloro-3-[4-[1-[4-(3-chloro-2-hydroxypropoxy)phenyl]ethyl]phenoxy]propan-2-ol |
| SMILES | CC(c1ccc(OCC(O)CCl)cc1)c1ccc(OCC(O)CCl)cc1 |
| InChI | InChI=1S/C20H24Cl2O4/c1-14(15-2-6-19(7-3-15)25-12-17(23)10-21)16-4-8-20(9-5-16)26-13-18(24)11-22/h2-9,14,17-18,23-24H,10-13H2,1H3 |
| InChIKey | ZCRRVWPNAUNCBO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|