C26H26O8 — CID 169320175
[2-hydroxy-3-[4-[1-[4-(2-hydroxy-3-prop-2-ynoyloxypropoxy)phenyl]ethyl]phenoxy]propyl] prop-2-ynoate (PubChem CID 169320175) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[1-[4-(2-hydroxy-3-prop-2-ynoyloxypropoxy)phenyl]ethyl]phenoxy]propyl] prop-2-ynoate.
| Compound Name | [2-hydroxy-3-[4-[1-[4-(2-hydroxy-3-prop-2-ynoyloxypropoxy)phenyl]ethyl]phenoxy]propyl] prop-2-ynoate |
|---|---|
| PubChem CID | 169320175 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [2-hydroxy-3-[4-[1-[4-(2-hydroxy-3-prop-2-ynoyloxypropoxy)phenyl]ethyl]phenoxy]propyl] prop-2-ynoate |
| SMILES | C#CC(=O)OCC(O)COc1ccc(C(C)c2ccc(OCC(O)COC(=O)C#C)cc2)cc1 |
| InChI | InChI=1S/C26H26O8/c1-4-25(29)33-16-21(27)14-31-23-10-6-19(7-11-23)18(3)20-8-12-24(13-9-20)32-15-22(28)17-34-26(30)5-2/h1-2,6-13,18,21-22,27-28H,14-17H2,3H3 |
| InChIKey | SZCJLQXOHOKBAH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|