C12H15NO2 — CID 60884579
2-[4-(2-hydroxybutoxy)phenyl]acetonitrile (PubChem CID 60884579) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[4-(2-hydroxybutoxy)phenyl]acetonitrile.
| Compound Name | 2-[4-(2-hydroxybutoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 60884579 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[4-(2-hydroxybutoxy)phenyl]acetonitrile |
| SMILES | CCC(O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C12H15NO2/c1-2-11(14)9-15-12-5-3-10(4-6-12)7-8-13/h3-6,11,14H,2,7,9H2,1H3 |
| InChIKey | UVCZVNRRBVHKAN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |