C22H27O4W- — CID 162126858
formaldehyde;1-[4-[(4-propoxyphenyl)methyl]phenoxy]pent-4-en-2-ol;tungsten (PubChem CID 162126858) has the molecular formula C22H27O4W- and a molecular weight of 539.29 g/mol. Its IUPAC name is formaldehyde;1-[4-[(4-propoxyphenyl)methyl]phenoxy]pent-4-en-2-ol;tungsten.
| Compound Name | formaldehyde;1-[4-[(4-propoxyphenyl)methyl]phenoxy]pent-4-en-2-ol;tungsten |
|---|---|
| PubChem CID | 162126858 |
| Molecular Formula | C22H27O4W- |
| Molecular Weight | 539.29 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | formaldehyde;1-[4-[(4-propoxyphenyl)methyl]phenoxy]pent-4-en-2-ol;tungsten |
| SMILES | C=CCC(O)COc1ccc(Cc2ccc(OCC[CH2-])cc2)cc1.C=O.[W] |
| InChI | InChI=1S/C21H25O3.CH2O.W/c1-3-5-19(22)16-24-21-12-8-18(9-13-21)15-17-6-10-20(11-7-17)23-14-4-2;1-2;/h3,6-13,19,22H,1-2,4-5,14-16H2;1H2;/q-1;; |
| InChIKey | CVVCWCQPGAPJQK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|