C22H27O5W- — CID 161327558
formaldehyde;1-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]pent-4-en-2-ol;tungsten (PubChem CID 161327558) has the molecular formula C22H27O5W- and a molecular weight of 555.29 g/mol. Its IUPAC name is formaldehyde;1-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]pent-4-en-2-ol;tungsten.
| Compound Name | formaldehyde;1-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]pent-4-en-2-ol;tungsten |
|---|---|
| PubChem CID | 161327558 |
| Molecular Formula | C22H27O5W- |
| Molecular Weight | 555.29 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | formaldehyde;1-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]pent-4-en-2-ol;tungsten |
| SMILES | C=CCC(O)COc1ccc(Cc2ccc(OC[CH-]CO)cc2)cc1.C=O.[W] |
| InChI | InChI=1S/C21H25O4.CH2O.W/c1-2-4-19(23)16-25-21-11-7-18(8-12-21)15-17-5-9-20(10-6-17)24-14-3-13-22;1-2;/h2-3,5-12,19,22-23H,1,4,13-16H2;1H2;/q-1;; |
| InChIKey | WWMHXIBGJLUICV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|