C19H21F2O4W- — CID 158922205
1,1-difluoro-3-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol;tungsten (PubChem CID 158922205) has the molecular formula C19H21F2O4W- and a molecular weight of 535.21 g/mol. Its IUPAC name is 1,1-difluoro-3-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol;tungsten.
| Compound Name | 1,1-difluoro-3-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol;tungsten |
|---|---|
| PubChem CID | 158922205 |
| Molecular Formula | C19H21F2O4W- |
| Molecular Weight | 535.21 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 1,1-difluoro-3-[4-[[4-(3-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol;tungsten |
| SMILES | OC[CH-]COc1ccc(Cc2ccc(OCC(O)C(F)F)cc2)cc1.[W] |
| InChI | InChI=1S/C19H21F2O4.W/c20-19(21)18(23)13-25-17-8-4-15(5-9-17)12-14-2-6-16(7-3-14)24-11-1-10-22;/h1-9,18-19,22-23H,10-13H2;/q-1; |
| InChIKey | LTPCVKSBGAXFPF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|