C16H24FN3O3 — CID 103296906
tert-butyl N-[3-[(5-amino-2-fluoro-3-methylbenzoyl)amino]propyl]carbamate (PubChem CID 103296906) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-amino-2-fluoro-3-methylbenzoyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-amino-2-fluoro-3-methylbenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103296906 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl N-[3-[(5-amino-2-fluoro-3-methylbenzoyl)amino]propyl]carbamate |
| SMILES | Cc1cc(N)cc(C(=O)NCCCNC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C16H24FN3O3/c1-10-8-11(18)9-12(13(10)17)14(21)19-6-5-7-20-15(22)23-16(2,3)4/h8-9H,5-7,18H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | ZLOXXADIJMLZGY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|