C17H27FN2O — CID 103296661
5-amino-N-(2,2-dimethylheptyl)-2-fluoro-3-methylbenzamide (PubChem CID 103296661) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is 5-amino-N-(2,2-dimethylheptyl)-2-fluoro-3-methylbenzamide.
| Compound Name | 5-amino-N-(2,2-dimethylheptyl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 103296661 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-amino-N-(2,2-dimethylheptyl)-2-fluoro-3-methylbenzamide |
| SMILES | CCCCCC(C)(C)CNC(=O)c1cc(N)cc(C)c1F |
| InChI | InChI=1S/C17H27FN2O/c1-5-6-7-8-17(3,4)11-20-16(21)14-10-13(19)9-12(2)15(14)18/h9-10H,5-8,11,19H2,1-4H3,(H,20,21) |
| InChIKey | HZNVOSJETSOJBY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|