C16H26N2O2 — CID 103747347
N-(2,2-dimethylheptyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103747347) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2,2-dimethylheptyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103747347 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(2,2-dimethylheptyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCCC(C)(C)CNC(=O)c1c[nH]c(C)cc1=O |
| InChI | InChI=1S/C16H26N2O2/c1-5-6-7-8-16(3,4)11-18-15(20)13-10-17-12(2)9-14(13)19/h9-10H,5-8,11H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | MNQOUOAOTHYEHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|