About N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide
N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 110855743) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 110855743 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1c[nH]c(C)cc1=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-5-6-14(3)12(16)10-8-13-9(2)7-11(10)15/h7-8H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | MIUWDZIURZIQHO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide (CID 110855743) is N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide is CCCCN(C)C(=O)c1c[nH]c(C)cc1=O.
What is the InChIKey of N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide?
The InChIKey is MIUWDZIURZIQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-4-5-6-14(3)12(16)10-8-13-9(2)7-11(10)15/h7-8H,4-6H2,1-3H3,(H,13,15).
What are the key properties of N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide?
N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide has a molecular weight of 222.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 110855743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).