C12H18N2O2 — CID 110855743
N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 110855743) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110855743 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-butyl-N,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1c[nH]c(C)cc1=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-5-6-14(3)12(16)10-8-13-9(2)7-11(10)15/h7-8H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | MIUWDZIURZIQHO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |