C12H20N2O2Si — CID 154765821
N,6-dimethyl-4-oxo-N-(trimethylsilylmethyl)-1H-pyridine-3-carboxamide (PubChem CID 154765821) has the molecular formula C12H20N2O2Si and a molecular weight of 252.39 g/mol. Its IUPAC name is N,6-dimethyl-4-oxo-N-(trimethylsilylmethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N,6-dimethyl-4-oxo-N-(trimethylsilylmethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154765821 |
| Molecular Formula | C12H20N2O2Si |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N,6-dimethyl-4-oxo-N-(trimethylsilylmethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)N(C)C[Si](C)(C)C)c[nH]1 |
| InChI | InChI=1S/C12H20N2O2Si/c1-9-6-11(15)10(7-13-9)12(16)14(2)8-17(3,4)5/h6-7H,8H2,1-5H3,(H,13,15) |
| InChIKey | GQKUJRBAOBPAAP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|