C15H26N2O2 — CID 160550782
N-(2,2-dimethylheptyl)-5-ethyl-1,2-oxazole-3-carboxamide (PubChem CID 160550782) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-5-ethyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2,2-dimethylheptyl)-5-ethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 160550782 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-(2,2-dimethylheptyl)-5-ethyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCC(C)(C)CNC(=O)c1cc(CC)on1 |
| InChI | InChI=1S/C15H26N2O2/c1-5-7-8-9-15(3,4)11-16-14(18)13-10-12(6-2)19-17-13/h10H,5-9,11H2,1-4H3,(H,16,18) |
| InChIKey | WJWQWRVAFFDEMV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|