C16H28N2O2 — CID 158921708
N-(3,3-dimethyloctan-2-yl)-5-ethyl-1,2-oxazole-3-carboxamide (PubChem CID 158921708) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-(3,3-dimethyloctan-2-yl)-5-ethyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3,3-dimethyloctan-2-yl)-5-ethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 158921708 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-(3,3-dimethyloctan-2-yl)-5-ethyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCC(C)(C)C(C)NC(=O)c1cc(CC)on1 |
| InChI | InChI=1S/C16H28N2O2/c1-6-8-9-10-16(4,5)12(3)17-15(19)14-11-13(7-2)20-18-14/h11-12H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | RSMBAQAFIPVCJK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|