C15H27N3O3 — CID 118698819
N-[3-(butylamino)-2,2-dimethylbutyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 118698819) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[3-(butylamino)-2,2-dimethylbutyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(butylamino)-2,2-dimethylbutyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118698819 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[3-(butylamino)-2,2-dimethylbutyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCNC(C)C(C)(C)CNC(=O)c1cc(CO)on1 |
| InChI | InChI=1S/C15H27N3O3/c1-5-6-7-16-11(2)15(3,4)10-17-14(20)13-8-12(9-19)21-18-13/h8,11,16,19H,5-7,9-10H2,1-4H3,(H,17,20) |
| InChIKey | OJJKLKNEUZBFOD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|