C11H20N3O3P — CID 145009032
N-[2-ethyl-2-(phosphanylamino)butyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 145009032) has the molecular formula C11H20N3O3P and a molecular weight of 273.27 g/mol. Its IUPAC name is N-[2-ethyl-2-(phosphanylamino)butyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-ethyl-2-(phosphanylamino)butyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 145009032 |
| Molecular Formula | C11H20N3O3P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[2-ethyl-2-(phosphanylamino)butyl]-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCC(CC)(CNC(=O)c1cc(CO)on1)NP |
| InChI | InChI=1S/C11H20N3O3P/c1-3-11(4-2,14-18)7-12-10(16)9-5-8(6-15)17-13-9/h5,14-15H,3-4,6-7,18H2,1-2H3,(H,12,16) |
| InChIKey | HDXGFUGLNFXZFV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|