3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid

C11H16N2O4 — CID 110836534

IUPAC3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid
SMILESCCc1cc(C(=O)NC(C)(C)CC(=O)O)no1
InChIInChI=1S/C11H16N2O4/c1-4-7-5-8(13-17-7)10(16)12-11(2,3)6-9(14)15/h5H,4,6H2,1-3H3,(H,12,16)(H,14,15)
InChIKeyUUZMLLRXPKUZHQ-UHFFFAOYSA-N
MW240.26 g/mol
LogP1.22
Rot. Bonds5

About 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid

3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 110836534) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid
PubChem CID110836534
Molecular FormulaC11H16N2O4
Molecular Weight240.26 g/mol
Exact Mass240.11
IUPAC Name3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid
SMILESCCc1cc(C(=O)NC(C)(C)CC(=O)O)no1
InChIInChI=1S/C11H16N2O4/c1-4-7-5-8(13-17-7)10(16)12-11(2,3)6-9(14)15/h5H,4,6H2,1-3H3,(H,12,16)(H,14,15)
InChIKeyUUZMLLRXPKUZHQ-UHFFFAOYSA-N
XLogP1.22
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid?
The IUPAC name of 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid (CID 110836534) is 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid.
What is the SMILES notation for 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid?
The canonical SMILES for 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid is CCc1cc(C(=O)NC(C)(C)CC(=O)O)no1.
What is the InChIKey of 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid?
The InChIKey is UUZMLLRXPKUZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-4-7-5-8(13-17-7)10(16)12-11(2,3)6-9(14)15/h5H,4,6H2,1-3H3,(H,12,16)(H,14,15).
What are the key properties of 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid?
3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid has a molecular weight of 240.26 g/mol, XLogP of 1.22, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-ethyl-1,2-oxazole-3-carbonyl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 110836534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).