C18H24N2O — CID 22364696
3-[4-(3,6-dihydro-2H-pyridin-1-yl)butyl]-5-methoxy-1H-indole (PubChem CID 22364696) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[4-(3,6-dihydro-2H-pyridin-1-yl)butyl]-5-methoxy-1H-indole.
| Compound Name | 3-[4-(3,6-dihydro-2H-pyridin-1-yl)butyl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 22364696 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-[4-(3,6-dihydro-2H-pyridin-1-yl)butyl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(CCCCN3CC=CCC3)c2c1 |
| InChI | InChI=1S/C18H24N2O/c1-21-16-8-9-18-17(13-16)15(14-19-18)7-3-6-12-20-10-4-2-5-11-20/h2,4,8-9,13-14,19H,3,5-7,10-12H2,1H3 |
| InChIKey | KQHDSJODPGJWCB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|