C26H29N3O2 — CID 67713328
2-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-ol (PubChem CID 67713328) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-ol.
| Compound Name | 2-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 67713328 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-ol |
| SMILES | COc1ccc2[nH]cc(CCCCN3CC=C(c4cc5cc(O)ccc5[nH]4)CC3)c2c1 |
| InChI | InChI=1S/C26H29N3O2/c1-31-22-6-8-25-23(16-22)19(17-27-25)4-2-3-11-29-12-9-18(10-13-29)26-15-20-14-21(30)5-7-24(20)28-26/h5-9,14-17,27-28,30H,2-4,10-13H2,1H3 |
| InChIKey | WHTUEHLHMMSIMV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|