C25H32N2 — CID 70545083
4,7-dimethyl-3-[4-(4-phenylpiperidin-1-yl)butyl]-1H-indole (PubChem CID 70545083) has the molecular formula C25H32N2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 4,7-dimethyl-3-[4-(4-phenylpiperidin-1-yl)butyl]-1H-indole.
| Compound Name | 4,7-dimethyl-3-[4-(4-phenylpiperidin-1-yl)butyl]-1H-indole |
|---|---|
| PubChem CID | 70545083 |
| Molecular Formula | C25H32N2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 4,7-dimethyl-3-[4-(4-phenylpiperidin-1-yl)butyl]-1H-indole |
| SMILES | Cc1ccc(C)c2c(CCCCN3CCC(c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C25H32N2/c1-19-11-12-20(2)25-24(19)23(18-26-25)10-6-7-15-27-16-13-22(14-17-27)21-8-4-3-5-9-21/h3-5,8-9,11-12,18,22,26H,6-7,10,13-17H2,1-2H3 |
| InChIKey | HTGHWMNSUQWKMS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|