C28H29F3N2O — CID 159064661
N,N-diphenyl-4-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]butanamide (PubChem CID 159064661) has the molecular formula C28H29F3N2O and a molecular weight of 466.55 g/mol. Its IUPAC name is N,N-diphenyl-4-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]butanamide.
| Compound Name | N,N-diphenyl-4-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]butanamide |
|---|---|
| PubChem CID | 159064661 |
| Molecular Formula | C28H29F3N2O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N,N-diphenyl-4-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]butanamide |
| SMILES | O=C(CCCN1CCC(c2cccc(C(F)(F)F)c2)CC1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29F3N2O/c29-28(30,31)24-10-7-9-23(21-24)22-16-19-32(20-17-22)18-8-15-27(34)33(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-7,9-14,21-22H,8,15-20H2 |
| InChIKey | YPIXWQVXIKTPLB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |