C29H33N3O2 — CID 70010240
2-[N-[4-(4-phenylazepan-1-yl)butanoyl]anilino]benzamide (PubChem CID 70010240) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[N-[4-(4-phenylazepan-1-yl)butanoyl]anilino]benzamide.
| Compound Name | 2-[N-[4-(4-phenylazepan-1-yl)butanoyl]anilino]benzamide |
|---|---|
| PubChem CID | 70010240 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 2-[N-[4-(4-phenylazepan-1-yl)butanoyl]anilino]benzamide |
| SMILES | NC(=O)c1ccccc1N(C(=O)CCCN1CCCC(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H33N3O2/c30-29(34)26-16-7-8-17-27(26)32(25-14-5-2-6-15-25)28(33)18-10-21-31-20-9-13-24(19-22-31)23-11-3-1-4-12-23/h1-8,11-12,14-17,24H,9-10,13,18-22H2,(H2,30,34) |
| InChIKey | ANFJJXGCXYDSPD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |