C13H20N2 — CID 89308417
2-[4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(3,4,5-13C3)azinan-1-yl]-1,1,2,2-tetradeuterio(113C)ethanamine (PubChem CID 89308417) has the molecular formula C13H20N2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(3,4,5-13C3)azinan-1-yl]-1,1,2,2-tetradeuterio(113C)ethanamine.
| Compound Name | 2-[4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(3,4,5-13C3)azinan-1-yl]-1,1,2,2-tetradeuterio(113C)ethanamine |
|---|---|
| PubChem CID | 89308417 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.22 |
| IUPAC Name | 2-[4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(3,4,5-13C3)azinan-1-yl]-1,1,2,2-tetradeuterio(113C)ethanamine |
| SMILES | [2H]C([2H])(N1C[13CH2][13CH]([13c]2[13cH][13cH][13cH][13cH][13cH]2)[13CH2]C1)[13C]([2H])([2H])N |
| InChI | InChI=1S/C13H20N2/c14-8-11-15-9-6-13(7-10-15)12-4-2-1-3-5-12/h1-5,13H,6-11,14H2/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1D2,11D2,12+1,13+1 |
| InChIKey | BFKSDLKIKGGPJK-FPOVXJIBSA-N |
| XLogP | 1.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |