C22H24F3NO — CID 162576798
4-phenyl-1-[4-[[4-(trifluoromethyl)-2-bicyclo[3.1.0]hexa-1,3,5-trienyl]oxy]butyl]piperidine (PubChem CID 162576798) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-phenyl-1-[4-[[4-(trifluoromethyl)-2-bicyclo[3.1.0]hexa-1,3,5-trienyl]oxy]butyl]piperidine.
| Compound Name | 4-phenyl-1-[4-[[4-(trifluoromethyl)-2-bicyclo[3.1.0]hexa-1,3,5-trienyl]oxy]butyl]piperidine |
|---|---|
| PubChem CID | 162576798 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-phenyl-1-[4-[[4-(trifluoromethyl)-2-bicyclo[3.1.0]hexa-1,3,5-trienyl]oxy]butyl]piperidine |
| SMILES | FC(F)(F)c1cc(OCCCCN2CCC(c3ccccc3)CC2)c2cc1-2 |
| InChI | InChI=1S/C22H24F3NO/c23-22(24,25)20-15-21(19-14-18(19)20)27-13-5-4-10-26-11-8-17(9-12-26)16-6-2-1-3-7-16/h1-3,6-7,14-15,17H,4-5,8-13H2 |
| InChIKey | ULCJBLNIPPXVAU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|