C28H35N3O4 — CID 67620834
butan-2-yl N-phenyl-N-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoyl]carbamate (PubChem CID 67620834) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is butan-2-yl N-phenyl-N-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoyl]carbamate.
| Compound Name | butan-2-yl N-phenyl-N-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoyl]carbamate |
|---|---|
| PubChem CID | 67620834 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | butan-2-yl N-phenyl-N-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoyl]carbamate |
| SMILES | CCCN1CCC(c2coc3ccc(NC(=O)N(C(=O)OC(C)CC)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-15-30-16-13-21(14-17-30)25-19-34-26-12-11-22(18-24(25)26)29-27(32)31(23-9-7-6-8-10-23)28(33)35-20(3)5-2/h6-12,18-21H,4-5,13-17H2,1-3H3,(H,29,32) |
| InChIKey | SSABOZWKTOVEGF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |