C13H19N3 — CID 69198367
4-(1-azabicyclo[2.2.2]octan-3-yl)benzene-1,3-diamine (PubChem CID 69198367) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-(1-azabicyclo[2.2.2]octan-3-yl)benzene-1,3-diamine.
| Compound Name | 4-(1-azabicyclo[2.2.2]octan-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 69198367 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-(1-azabicyclo[2.2.2]octan-3-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(C2CN3CCC2CC3)c(N)c1 |
| InChI | InChI=1S/C13H19N3/c14-10-1-2-11(13(15)7-10)12-8-16-5-3-9(12)4-6-16/h1-2,7,9,12H,3-6,8,14-15H2 |
| InChIKey | MCEAYKIESJHWSH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|