C16H23N3 — CID 79725122
1-N-(1-azabicyclo[2.2.2]octan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79725122) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79725122 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2NC1CN2CCC1CC2 |
| InChI | InChI=1S/C16H23N3/c17-13-2-3-14-12(9-13)1-4-15(14)18-16-10-19-7-5-11(16)6-8-19/h2-3,9,11,15-16,18H,1,4-8,10,17H2 |
| InChIKey | BYOQOBSAXYURNM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|