C13H18ClN3O2S — CID 43102600
5-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chlorobenzenesulfonamide (PubChem CID 43102600) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 5-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chlorobenzenesulfonamide.
| Compound Name | 5-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 43102600 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chlorobenzenesulfonamide |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)NC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C13H18ClN3O2S/c14-11-2-1-10(15)7-13(11)20(18,19)16-12-8-17-5-3-9(12)4-6-17/h1-2,7,9,12,16H,3-6,8,15H2 |
| InChIKey | VNXVCGJJVIUIIL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|